C19H7F11N2O2 — CID 177064553
4-[4-fluoro-3,5-bis(trifluoromethyl)benzoyl]-5-methyl-2-(2,3,5,6-tetrafluorophenyl)-1H-pyrazol-3-one (PubChem CID 177064553) has the molecular formula C19H7F11N2O2 and a molecular weight of 504.26 g/mol. Its IUPAC name is 4-[4-fluoro-3,5-bis(trifluoromethyl)benzoyl]-5-methyl-2-(2,3,5,6-tetrafluorophenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[4-fluoro-3,5-bis(trifluoromethyl)benzoyl]-5-methyl-2-(2,3,5,6-tetrafluorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177064553 |
| Molecular Formula | C19H7F11N2O2 |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 4-[4-fluoro-3,5-bis(trifluoromethyl)benzoyl]-5-methyl-2-(2,3,5,6-tetrafluorophenyl)-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2c(F)c(F)cc(F)c2F)c(=O)c1C(=O)c1cc(C(F)(F)F)c(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H7F11N2O2/c1-5-11(17(34)32(31-5)15-13(23)9(20)4-10(21)14(15)24)16(33)6-2-7(18(25,26)27)12(22)8(3-6)19(28,29)30/h2-4,31H,1H3 |
| InChIKey | PLRGIGZJFDPWSS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|