C16H6F7N3O2 — CID 177064880
4-(2,6-difluoropyridine-4-carbonyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one (PubChem CID 177064880) has the molecular formula C16H6F7N3O2 and a molecular weight of 405.23 g/mol. Its IUPAC name is 4-(2,6-difluoropyridine-4-carbonyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one.
| Compound Name | 4-(2,6-difluoropyridine-4-carbonyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177064880 |
| Molecular Formula | C16H6F7N3O2 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 4-(2,6-difluoropyridine-4-carbonyl)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2c(F)c(F)c(F)c(F)c2F)c(=O)c1C(=O)c1cc(F)nc(F)c1 |
| InChI | InChI=1S/C16H6F7N3O2/c1-4-8(15(27)5-2-6(17)24-7(18)3-5)16(28)26(25-4)14-12(22)10(20)9(19)11(21)13(14)23/h2-3,25H,1H3 |
| InChIKey | GKYYIJMQDPPPKP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|