C18H9F7N2O2 — CID 177064689
5-methyl-2-(2,3,5,6-tetrafluorophenyl)-4-[2-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one (PubChem CID 177064689) has the molecular formula C18H9F7N2O2 and a molecular weight of 418.27 g/mol. Its IUPAC name is 5-methyl-2-(2,3,5,6-tetrafluorophenyl)-4-[2-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one.
| Compound Name | 5-methyl-2-(2,3,5,6-tetrafluorophenyl)-4-[2-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177064689 |
| Molecular Formula | C18H9F7N2O2 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 5-methyl-2-(2,3,5,6-tetrafluorophenyl)-4-[2-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2c(F)c(F)cc(F)c2F)c(=O)c1C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H9F7N2O2/c1-7-12(16(28)8-4-2-3-5-9(8)18(23,24)25)17(29)27(26-7)15-13(21)10(19)6-11(20)14(15)22/h2-6,26H,1H3 |
| InChIKey | BOASPQAFJYMXRM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|