C17H7F9N3O2+ — CID 177064802
5-methyl-4-(3,4,5-trifluorobenzoyl)-2-[2,3,6-trifluoro-5-(trifluoromethyl)pyridin-1-ium-1-yl]-1H-pyrazol-3-one (PubChem CID 177064802) has the molecular formula C17H7F9N3O2+ and a molecular weight of 456.24 g/mol. Its IUPAC name is 5-methyl-4-(3,4,5-trifluorobenzoyl)-2-[2,3,6-trifluoro-5-(trifluoromethyl)pyridin-1-ium-1-yl]-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-(3,4,5-trifluorobenzoyl)-2-[2,3,6-trifluoro-5-(trifluoromethyl)pyridin-1-ium-1-yl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 177064802 |
| Molecular Formula | C17H7F9N3O2+ |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 5-methyl-4-(3,4,5-trifluorobenzoyl)-2-[2,3,6-trifluoro-5-(trifluoromethyl)pyridin-1-ium-1-yl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-[n+]2c(F)c(F)cc(C(F)(F)F)c2F)c(=O)c1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H6F9N3O2/c1-5-11(13(30)6-2-8(18)12(21)9(19)3-6)16(31)29(27-5)28-14(22)7(17(24,25)26)4-10(20)15(28)23/h2-4H,1H3/p+1 |
| InChIKey | BZNQPXQMSOSKLA-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|