C13H25N2O2+ — CID 177067993
tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate (PubChem CID 177067993) has the molecular formula C13H25N2O2+ and a molecular weight of 241.35 g/mol. Its IUPAC name is tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177067993 |
| Molecular Formula | C13H25N2O2+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([CH+]CCN)CC1 |
| InChI | InChI=1S/C13H25N2O2/c1-13(2,3)17-12(16)15-9-6-11(7-10-15)5-4-8-14/h5,11H,4,6-10,14H2,1-3H3/q+1 |
| InChIKey | YYZFXWUNJZMNCO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|