C10H11F4O4- — CID 177084903
2,2,3,3-tetrafluoro-4-(1-methylcyclopentyl)oxy-4-oxobutanoate (PubChem CID 177084903) has the molecular formula C10H11F4O4- and a molecular weight of 271.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-(1-methylcyclopentyl)oxy-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-(1-methylcyclopentyl)oxy-4-oxobutanoate |
|---|---|
| PubChem CID | 177084903 |
| Molecular Formula | C10H11F4O4- |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-(1-methylcyclopentyl)oxy-4-oxobutanoate |
| SMILES | CC1(OC(=O)C(F)(F)C(F)(F)C(=O)[O-])CCCC1 |
| InChI | InChI=1S/C10H12F4O4/c1-8(4-2-3-5-8)18-7(17)10(13,14)9(11,12)6(15)16/h2-5H2,1H3,(H,15,16)/p-1 |
| InChIKey | IESNHHNDXJHEMW-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|