C18H26F4O4 — CID 58372449
bis(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 58372449) has the molecular formula C18H26F4O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is bis(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | bis(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 58372449 |
| Molecular Formula | C18H26F4O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | bis(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | CCC1(OC(=O)C(F)(F)C(F)(F)C(=O)OC2(CC)CCCC2)CCCC1 |
| InChI | InChI=1S/C18H26F4O4/c1-3-15(9-5-6-10-15)25-13(23)17(19,20)18(21,22)14(24)26-16(4-2)11-7-8-12-16/h3-12H2,1-2H3 |
| InChIKey | FCJUUWMMJUVHIV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|