C22H28N4O4 — CID 177091022
1,1-diethyl-3-[2-[(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methylamino]ethyl]-3-methylurea (PubChem CID 177091022) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-[(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methylamino]ethyl]-3-methylurea.
| Compound Name | 1,1-diethyl-3-[2-[(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methylamino]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 177091022 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1,1-diethyl-3-[2-[(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methylamino]ethyl]-3-methylurea |
| SMILES | CCN(CC)C(=O)N(C)CCNCN1C(=O)c2cccc3c(OC)ccc(c23)C1=O |
| InChI | InChI=1S/C22H28N4O4/c1-5-25(6-2)22(29)24(3)13-12-23-14-26-20(27)16-9-7-8-15-18(30-4)11-10-17(19(15)16)21(26)28/h7-11,23H,5-6,12-14H2,1-4H3 |
| InChIKey | UOYBMHGZRNPQGB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|