C23H23IN4O2S — CID 177092975
(1-methylcyclopropyl) 2-[(9S)-7-(4-iodophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 177092975) has the molecular formula C23H23IN4O2S and a molecular weight of 546.43 g/mol. Its IUPAC name is (1-methylcyclopropyl) 2-[(9S)-7-(4-iodophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | (1-methylcyclopropyl) 2-[(9S)-7-(4-iodophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 177092975 |
| Molecular Formula | C23H23IN4O2S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | (1-methylcyclopropyl) 2-[(9S)-7-(4-iodophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(I)cc1)=N[C@@H](CC(=O)OC1(C)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C23H23IN4O2S/c1-12-13(2)31-22-19(12)20(15-5-7-16(24)8-6-15)25-17(21-27-26-14(3)28(21)22)11-18(29)30-23(4)9-10-23/h5-8,17H,9-11H2,1-4H3/t17-/m0/s1 |
| InChIKey | JRTZQQLSROGELJ-KRWDZBQOSA-N |
| XLogP | 5.24 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|