About (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine
(8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine (PubChem CID 177095504) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine.
Analyze (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine?
The IUPAC name of (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine (CID 177095504) is (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine.
What is the SMILES notation for (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine?
The canonical SMILES for (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine is CC[C@]12C=C(F)CN1CCC2.
What is the InChIKey of (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine?
The InChIKey is BLCJAZSGRDAWRG-VIFPVBQESA-N. The full InChI is InChI=1S/C9H14FN/c1-2-9-4-3-5-11(9)7-8(10)6-9/h6H,2-5,7H2,1H3/t9-/m0/s1.
What are the key properties of (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine?
(8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine has a molecular weight of 155.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-8-ethyl-6-fluoro-1,2,3,5-tetrahydropyrrolizine is sourced from PubChem (CID 177095504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).