C33H45N7O7 — CID 177101875
3-[N'-[4-[4-[4-[3-oxo-3-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethylamino]propyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 177101875) has the molecular formula C33H45N7O7 and a molecular weight of 651.77 g/mol. Its IUPAC name is 3-[N'-[4-[4-[4-[3-oxo-3-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethylamino]propyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3-[N'-[4-[4-[4-[3-oxo-3-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethylamino]propyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 177101875 |
| Molecular Formula | C33H45N7O7 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 3-[N'-[4-[4-[4-[3-oxo-3-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethylamino]propyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1nccnc1/C(N)=N/CCCCc1ccc(-c2ccc(CCC(=O)NCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc2)cc1 |
| InChI | InChI=1S/C33H45N7O7/c34-32(28-29(33(35)47)39-18-17-38-28)40-14-2-1-3-21-4-9-23(10-5-21)24-11-6-22(7-12-24)8-13-27(44)37-16-15-36-19-25(42)30(45)31(46)26(43)20-41/h4-7,9-12,17-18,25-26,30-31,36,41-43,45-46H,1-3,8,13-16,19-20H2,(H2,34,40)(H2,35,47)(H,37,44)/t25-,26+,30+,31+/m0/s1 |
| InChIKey | WZTMGHOERGCIDD-CMJXUMPWSA-N |
| XLogP | -0.95 |
| TPSA | 249.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|