C32H50N6O7 — CID 140611447
3-[N'-[4-[4-[2-[[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 140611447) has the molecular formula C32H50N6O7 and a molecular weight of 630.79 g/mol. Its IUPAC name is 3-[N'-[4-[4-[2-[[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3-[N'-[4-[4-[2-[[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 140611447 |
| Molecular Formula | C32H50N6O7 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | 3-[N'-[4-[4-[2-[[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propyl]-hexylamino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCCCCCN(CCOc1ccc(CCCC/N=C(\N)c2nccnc2C(N)=O)cc1)C[C@H](O)[C@@H](O)[C@@H]1OC(C)OC[C@H]1O |
| InChI | InChI=1S/C32H50N6O7/c1-3-4-5-8-17-38(20-25(39)29(41)30-26(40)21-44-22(2)45-30)18-19-43-24-12-10-23(11-13-24)9-6-7-14-37-31(33)27-28(32(34)42)36-16-15-35-27/h10-13,15-16,22,25-26,29-30,39-41H,3-9,14,17-21H2,1-2H3,(H2,33,37)(H2,34,42)/t22?,25-,26+,29+,30+/m0/s1 |
| InChIKey | KSXAKUKUQBECKC-IDHAKCNQSA-N |
| XLogP | 1.41 |
| TPSA | 198.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|