C30H49ClN8O7 — CID 142726946
N-[N'-[2,2-diamino-3-chloro-4-[4-[2-[hexyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 142726946) has the molecular formula C30H49ClN8O7 and a molecular weight of 669.22 g/mol. Its IUPAC name is N-[N'-[2,2-diamino-3-chloro-4-[4-[2-[hexyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | N-[N'-[2,2-diamino-3-chloro-4-[4-[2-[hexyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142726946 |
| Molecular Formula | C30H49ClN8O7 |
| Molecular Weight | 669.22 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | N-[N'-[2,2-diamino-3-chloro-4-[4-[2-[hexyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CCCCCCN(CCOc1ccc(CC(Cl)C(N)(N)C/N=C(\N)NC(=O)c2cnccn2)cc1)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C30H49ClN8O7/c1-2-3-4-5-12-39(17-23(41)26(43)27(44)24(42)18-40)13-14-46-21-8-6-20(7-9-21)15-25(31)30(33,34)19-37-29(32)38-28(45)22-16-35-10-11-36-22/h6-11,16,23-27,40-44H,2-5,12-15,17-19,33-34H2,1H3,(H3,32,37,38,45)/t23-,24+,25?,26+,27+/m0/s1 |
| InChIKey | KRRIKWPRGQTCQC-PCYRLFEISA-N |
| XLogP | -1.32 |
| TPSA | 258.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|