C27H41N3O3 — CID 169109700
3-[4-[4-(4-aminobutyl)phenyl]phenyl]-N-[2-(5,6-dihydroxyhexylamino)ethyl]propanamide (PubChem CID 169109700) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is 3-[4-[4-(4-aminobutyl)phenyl]phenyl]-N-[2-(5,6-dihydroxyhexylamino)ethyl]propanamide.
| Compound Name | 3-[4-[4-(4-aminobutyl)phenyl]phenyl]-N-[2-(5,6-dihydroxyhexylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 169109700 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 3-[4-[4-(4-aminobutyl)phenyl]phenyl]-N-[2-(5,6-dihydroxyhexylamino)ethyl]propanamide |
| SMILES | NCCCCc1ccc(-c2ccc(CCC(=O)NCCNCCCCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C27H41N3O3/c28-17-3-1-5-22-7-12-24(13-8-22)25-14-9-23(10-15-25)11-16-27(33)30-20-19-29-18-4-2-6-26(32)21-31/h7-10,12-15,26,29,31-32H,1-6,11,16-21,28H2,(H,30,33) |
| InChIKey | RJRADZWVYAHMPN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|