C55H43N4OPt-3 — CID 177105317
CID 177105317 (PubChem CID 177105317) has the molecular formula C55H43N4OPt-3 and a molecular weight of 982.12 g/mol.
| Compound Name | CID 177105317 |
|---|---|
| PubChem CID | 177105317 |
| Molecular Formula | C55H43N4OPt-3 |
| Molecular Weight | 982.12 g/mol |
| Exact Mass | 981.38 |
| IUPAC Name | — |
| SMILES | [2H]c1c(Oc2[c-]c3c(c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2n3-c2cc(C([2H])([2H])C(C)(C)C)ccn2)[c-]c(N2[CH-]n3c4c(C)cccc4c4cc(C)ccc4c4ccccc4c4cccc2c43)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C55H43N4O.Pt/c1-35-23-25-43-41-16-6-7-17-42(41)46-20-12-22-50-54(46)58(53-36(2)13-10-19-47(53)48(43)29-35)34-57(50)38-14-11-15-39(31-38)60-40-24-26-45-44-18-8-9-21-49(44)59(51(45)32-40)52-30-37(27-28-56-52)33-55(3,4)5;/h6-30,34H,33H2,1-5H3;/q-3;/i8D,9D,11D,14D,15D,18D,21D,24D,26D,33D2; |
| InChIKey | OCVDKDMOZREKAD-TYEVGVGMSA-N |
| XLogP | 14.43 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.12 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|