C21H30ClN3O4 — CID 177108117
4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-4-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 177108117) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-4-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-4-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177108117 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-4-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | O=C1CCC(N2CC3C(CNC(=O)C4CCC(Cl)CC4)CCCC3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H30ClN3O4/c22-14-6-4-12(5-7-14)19(27)23-10-13-2-1-3-15-16(13)11-25(21(15)29)17-8-9-18(26)24-20(17)28/h12-17H,1-11H2,(H,23,27)(H,24,26,28) |
| InChIKey | XAISKCMCBFMZKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|