C24H38N4O4 — CID 164836049
1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]-3-(4-propan-2-ylcyclohexyl)urea (PubChem CID 164836049) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]-3-(4-propan-2-ylcyclohexyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]-3-(4-propan-2-ylcyclohexyl)urea |
|---|---|
| PubChem CID | 164836049 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]-3-(4-propan-2-ylcyclohexyl)urea |
| SMILES | CC(C)C1CCC(NC(=O)NCC2CCC3CN(C4CCC(=O)NC4=O)C(=O)C3C2)CC1 |
| InChI | InChI=1S/C24H38N4O4/c1-14(2)16-5-7-18(8-6-16)26-24(32)25-12-15-3-4-17-13-28(23(31)19(17)11-15)20-9-10-21(29)27-22(20)30/h14-20H,3-13H2,1-2H3,(H2,25,26,32)(H,27,29,30) |
| InChIKey | LQANDBHIGLCHOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|