C20H28F3N3O5S — CID 164938640
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide (PubChem CID 164938640) has the molecular formula C20H28F3N3O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 164938640 |
| Molecular Formula | C20H28F3N3O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide |
| SMILES | O=C1CCC(N2CC3CC(NS(=O)(=O)C4CCCC(C(F)(F)F)C4)CCC3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H28F3N3O5S/c21-20(22,23)12-2-1-3-14(9-12)32(30,31)25-13-4-5-15-11(8-13)10-26(19(15)29)16-6-7-17(27)24-18(16)28/h11-16,25H,1-10H2,(H,24,27,28) |
| InChIKey | PZMWBQUVGFXCEA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|