C24H34N4O3 — CID 169034793
3-[6-[1-(cyclohexylmethyl)-4-methylpyrazol-3-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169034793) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[6-[1-(cyclohexylmethyl)-4-methylpyrazol-3-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(cyclohexylmethyl)-4-methylpyrazol-3-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169034793 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 3-[6-[1-(cyclohexylmethyl)-4-methylpyrazol-3-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cn(CC2CCCCC2)nc1C1CCC2C(=O)N(C3CCC(=O)NC3=O)CC2C1 |
| InChI | InChI=1S/C24H34N4O3/c1-15-12-27(13-16-5-3-2-4-6-16)26-22(15)17-7-8-19-18(11-17)14-28(24(19)31)20-9-10-21(29)25-23(20)30/h12,16-20H,2-11,13-14H2,1H3,(H,25,29,30) |
| InChIKey | COWDDPZQZBZIJW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|