C23H36N4O4 — CID 164836036
1-(1-cyclohexylethyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]urea (PubChem CID 164836036) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-(1-cyclohexylethyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-(1-cyclohexylethyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 164836036 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-(1-cyclohexylethyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-5-yl]methyl]urea |
| SMILES | CC(NC(=O)NCC1CCC2CN(C3CCC(=O)NC3=O)C(=O)C2C1)C1CCCCC1 |
| InChI | InChI=1S/C23H36N4O4/c1-14(16-5-3-2-4-6-16)25-23(31)24-12-15-7-8-17-13-27(22(30)18(17)11-15)19-9-10-20(28)26-21(19)29/h14-19H,2-13H2,1H3,(H2,24,25,31)(H,26,28,29) |
| InChIKey | NLCJTXKNISRASH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|