C21H30F4N3O3+ — CID 177113632
tert-butyl 3-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-hydroxypyridin-1-ium-4-yl]-4,4-difluoropiperidine-1-carboxylate (PubChem CID 177113632) has the molecular formula C21H30F4N3O3+ and a molecular weight of 448.48 g/mol. Its IUPAC name is tert-butyl 3-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-hydroxypyridin-1-ium-4-yl]-4,4-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-hydroxypyridin-1-ium-4-yl]-4,4-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177113632 |
| Molecular Formula | C21H30F4N3O3+ |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tert-butyl 3-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-hydroxypyridin-1-ium-4-yl]-4,4-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)C(c2cc[n+](O)c(CN3CCC(F)(F)CC3)c2)C1 |
| InChI | InChI=1S/C21H30F4N3O3/c1-19(2,3)31-18(29)27-11-7-21(24,25)17(14-27)15-4-8-28(30)16(12-15)13-26-9-5-20(22,23)6-10-26/h4,8,12,17,30H,5-7,9-11,13-14H2,1-3H3/q+1 |
| InChIKey | DSEPPTZLYCLSPH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|