C23H24F4N5O2+ — CID 177113638
(2S)-2-[(3S)-4,4-difluoro-3-(1-hydroxypyridin-1-ium-4-yl)piperidin-1-yl]-N-[1-[(2,3-difluorophenyl)methyl]imidazol-4-yl]propanamide (PubChem CID 177113638) has the molecular formula C23H24F4N5O2+ and a molecular weight of 478.47 g/mol. Its IUPAC name is (2S)-2-[(3S)-4,4-difluoro-3-(1-hydroxypyridin-1-ium-4-yl)piperidin-1-yl]-N-[1-[(2,3-difluorophenyl)methyl]imidazol-4-yl]propanamide.
| Compound Name | (2S)-2-[(3S)-4,4-difluoro-3-(1-hydroxypyridin-1-ium-4-yl)piperidin-1-yl]-N-[1-[(2,3-difluorophenyl)methyl]imidazol-4-yl]propanamide |
|---|---|
| PubChem CID | 177113638 |
| Molecular Formula | C23H24F4N5O2+ |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (2S)-2-[(3S)-4,4-difluoro-3-(1-hydroxypyridin-1-ium-4-yl)piperidin-1-yl]-N-[1-[(2,3-difluorophenyl)methyl]imidazol-4-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cn(Cc2cccc(F)c2F)cn1)N1CCC(F)(F)[C@@H](c2cc[n+](O)cc2)C1 |
| InChI | InChI=1S/C23H23F4N5O2/c1-15(31-10-7-23(26,27)18(12-31)16-5-8-32(34)9-6-16)22(33)29-20-13-30(14-28-20)11-17-3-2-4-19(24)21(17)25/h2-6,8-9,13-15,18H,7,10-12H2,1H3,(H-,29,33,34)/p+1/t15-,18+/m0/s1 |
| InChIKey | QKVUCHCEWHTDKP-MAUKXSAKSA-O |
| XLogP | 3.19 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|