C27H30F2N5O2+ — CID 177113688
(2S)-N-[(5R)-5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl]-2-[(8S)-8-(1-hydroxypyridin-1-ium-4-yl)-6-azaspiro[2.5]octan-6-yl]propanamide (PubChem CID 177113688) has the molecular formula C27H30F2N5O2+ and a molecular weight of 494.57 g/mol. Its IUPAC name is (2S)-N-[(5R)-5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl]-2-[(8S)-8-(1-hydroxypyridin-1-ium-4-yl)-6-azaspiro[2.5]octan-6-yl]propanamide.
| Compound Name | (2S)-N-[(5R)-5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl]-2-[(8S)-8-(1-hydroxypyridin-1-ium-4-yl)-6-azaspiro[2.5]octan-6-yl]propanamide |
|---|---|
| PubChem CID | 177113688 |
| Molecular Formula | C27H30F2N5O2+ |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (2S)-N-[(5R)-5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl]-2-[(8S)-8-(1-hydroxypyridin-1-ium-4-yl)-6-azaspiro[2.5]octan-6-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cn2c(n1)CC[C@@H]2c1cc(F)cc(F)c1)N1CCC2(CC2)[C@@H](c2cc[n+](O)cc2)C1 |
| InChI | InChI=1S/C27H29F2N5O2/c1-17(32-11-8-27(6-7-27)22(15-32)18-4-9-33(36)10-5-18)26(35)31-24-16-34-23(2-3-25(34)30-24)19-12-20(28)14-21(29)13-19/h4-5,9-10,12-14,16-17,22-23H,2-3,6-8,11,15H2,1H3,(H-,31,35,36)/p+1/t17-,22+,23+/m0/s1 |
| InChIKey | MWAGSZOGWYFJQE-JJEOQYAHSA-O |
| XLogP | 3.82 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|