C30H41NSi — CID 177122780
[6-(4-tert-butylnaphthalen-2-yl)-4-(4,4-dimethylcyclohexyl)-3-pyridinyl]-trimethylsilane (PubChem CID 177122780) has the molecular formula C30H41NSi and a molecular weight of 443.75 g/mol. Its IUPAC name is [6-(4-tert-butylnaphthalen-2-yl)-4-(4,4-dimethylcyclohexyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(4-tert-butylnaphthalen-2-yl)-4-(4,4-dimethylcyclohexyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 177122780 |
| Molecular Formula | C30H41NSi |
| Molecular Weight | 443.75 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | [6-(4-tert-butylnaphthalen-2-yl)-4-(4,4-dimethylcyclohexyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC1(C)CCC(c2cc(-c3cc(C(C)(C)C)c4ccccc4c3)ncc2[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C30H41NSi/c1-29(2,3)26-18-23(17-22-11-9-10-12-24(22)26)27-19-25(28(20-31-27)32(6,7)8)21-13-15-30(4,5)16-14-21/h9-12,17-21H,13-16H2,1-8H3 |
| InChIKey | ILJNYEPZLTVXRU-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.75 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|