C27H34 — CID 155760218
2-tert-butyl-4-(4,4-dimethylcyclohexyl)-1-methylanthracene (PubChem CID 155760218) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-tert-butyl-4-(4,4-dimethylcyclohexyl)-1-methylanthracene.
| Compound Name | 2-tert-butyl-4-(4,4-dimethylcyclohexyl)-1-methylanthracene |
|---|---|
| PubChem CID | 155760218 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-tert-butyl-4-(4,4-dimethylcyclohexyl)-1-methylanthracene |
| SMILES | Cc1c(C(C)(C)C)cc(C2CCC(C)(C)CC2)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C27H34/c1-18-22-15-20-9-7-8-10-21(20)16-24(22)23(17-25(18)26(2,3)4)19-11-13-27(5,6)14-12-19/h7-10,15-17,19H,11-14H2,1-6H3 |
| InChIKey | BKTDIALHHBCITF-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|