C44H63N — CID 158696122
2-tert-butyl-1-methyl-4-(3,3,5,5-tetramethylcyclohexyl)naphthalene;6,8-ditert-butyl-2,5-dimethylquinoline (PubChem CID 158696122) has the molecular formula C44H63N and a molecular weight of 606.00 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-4-(3,3,5,5-tetramethylcyclohexyl)naphthalene;6,8-ditert-butyl-2,5-dimethylquinoline.
| Compound Name | 2-tert-butyl-1-methyl-4-(3,3,5,5-tetramethylcyclohexyl)naphthalene;6,8-ditert-butyl-2,5-dimethylquinoline |
|---|---|
| PubChem CID | 158696122 |
| Molecular Formula | C44H63N |
| Molecular Weight | 606.00 g/mol |
| Exact Mass | 605.50 |
| IUPAC Name | 2-tert-butyl-1-methyl-4-(3,3,5,5-tetramethylcyclohexyl)naphthalene;6,8-ditert-butyl-2,5-dimethylquinoline |
| SMILES | Cc1c(C(C)(C)C)cc(C2CC(C)(C)CC(C)(C)C2)c2ccccc12.Cc1ccc2c(C)c(C(C)(C)C)cc(C(C)(C)C)c2n1 |
| InChI | InChI=1S/C25H36.C19H27N/c1-17-19-11-9-10-12-20(19)21(13-22(17)23(2,3)4)18-14-24(5,6)16-25(7,8)15-18;1-12-9-10-14-13(2)15(18(3,4)5)11-16(17(14)20-12)19(6,7)8/h9-13,18H,14-16H2,1-8H3;9-11H,1-8H3 |
| InChIKey | IGYVMLWNJSOBAK-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.00 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |