C14H24F2N2O — CID 177134533
3,3-difluoro-4-(4-propan-2-ylpiperidin-1-yl)piperidine-1-carbaldehyde (PubChem CID 177134533) has the molecular formula C14H24F2N2O and a molecular weight of 274.35 g/mol. Its IUPAC name is 3,3-difluoro-4-(4-propan-2-ylpiperidin-1-yl)piperidine-1-carbaldehyde.
| Compound Name | 3,3-difluoro-4-(4-propan-2-ylpiperidin-1-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 177134533 |
| Molecular Formula | C14H24F2N2O |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3,3-difluoro-4-(4-propan-2-ylpiperidin-1-yl)piperidine-1-carbaldehyde |
| SMILES | CC(C)C1CCN(C2CCN(C=O)CC2(F)F)CC1 |
| InChI | InChI=1S/C14H24F2N2O/c1-11(2)12-3-7-18(8-4-12)13-5-6-17(10-19)9-14(13,15)16/h10-13H,3-9H2,1-2H3 |
| InChIKey | BEGVLVSVMBHFDB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|