C11H14N5O4P — CID 177135968
[(5-cyano-7-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]methyl dihydrogen phosphate (PubChem CID 177135968) has the molecular formula C11H14N5O4P and a molecular weight of 311.24 g/mol. Its IUPAC name is [(5-cyano-7-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]methyl dihydrogen phosphate.
| Compound Name | [(5-cyano-7-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 177135968 |
| Molecular Formula | C11H14N5O4P |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [(5-cyano-7-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]methyl dihydrogen phosphate |
| SMILES | CC(C)c1cc(C#N)c2c(NCOP(=O)(O)O)ncnn12 |
| InChI | InChI=1S/C11H14N5O4P/c1-7(2)9-3-8(4-12)10-11(13-5-15-16(9)10)14-6-20-21(17,18)19/h3,5,7H,6H2,1-2H3,(H,13,14,15)(H2,17,18,19) |
| InChIKey | VHFNGDINRBVDTM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|