C13H17N5O4 — CID 173483151
4-amino-7-[(1R,2R,3R)-2,3,4-trihydroxy-1-methoxy-2-methylbutyl]pyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile (PubChem CID 173483151) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-amino-7-[(1R,2R,3R)-2,3,4-trihydroxy-1-methoxy-2-methylbutyl]pyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile.
| Compound Name | 4-amino-7-[(1R,2R,3R)-2,3,4-trihydroxy-1-methoxy-2-methylbutyl]pyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
|---|---|
| PubChem CID | 173483151 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-amino-7-[(1R,2R,3R)-2,3,4-trihydroxy-1-methoxy-2-methylbutyl]pyrrolo[2,1-f][1,2,4]triazine-5-carbonitrile |
| SMILES | CO[C@H](c1cc(C#N)c2c(N)ncnn12)[C@](C)(O)[C@H](O)CO |
| InChI | InChI=1S/C13H17N5O4/c1-13(21,9(20)5-19)11(22-2)8-3-7(4-14)10-12(15)16-6-17-18(8)10/h3,6,9,11,19-21H,5H2,1-2H3,(H2,15,16,17)/t9-,11-,13-/m1/s1 |
| InChIKey | RUQRQXJYEXSLCF-IRUJWGPZSA-N |
| XLogP | -1.03 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |