C17H20FN5O5 — CID 167155664
[(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 167155664) has the molecular formula C17H20FN5O5 and a molecular weight of 393.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167155664 |
| Molecular Formula | C17H20FN5O5 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@](C#N)(c2cc(F)c3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20FN5O5/c1-16(2,3)15(26)27-5-9-12(24)13(25)17(6-19,28-9)10-4-8(18)11-14(20)21-7-22-23(10)11/h4,7,9,12-13,24-25H,5H2,1-3H3,(H2,20,21,22)/t9-,12-,13-,17+/m1/s1 |
| InChIKey | HUDWGXAVWCTOBM-HYNLGEKVSA-N |
| XLogP | -0.12 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |