C17H18FN5O5 — CID 167155669
[(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl cyclobutanecarboxylate (PubChem CID 167155669) has the molecular formula C17H18FN5O5 and a molecular weight of 391.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl cyclobutanecarboxylate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl cyclobutanecarboxylate |
|---|---|
| PubChem CID | 167155669 |
| Molecular Formula | C17H18FN5O5 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl cyclobutanecarboxylate |
| SMILES | N#C[C@@]1(c2cc(F)c3c(N)ncnn23)O[C@H](COC(=O)C2CCC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18FN5O5/c18-9-4-11(23-12(9)15(20)21-7-22-23)17(6-19)14(25)13(24)10(28-17)5-27-16(26)8-2-1-3-8/h4,7-8,10,13-14,24-25H,1-3,5H2,(H2,20,21,22)/t10-,13-,14-,17+/m1/s1 |
| InChIKey | KVFDXJDPDDLMHX-PRBJMDPQSA-N |
| XLogP | -0.37 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |