C28H29N5O — CID 177143380
(1Z)-1-[amino-[1-(2-naphthalen-2-ylethyl)piperidin-3-yl]methylidene]-3-isoquinolin-5-ylurea (PubChem CID 177143380) has the molecular formula C28H29N5O and a molecular weight of 451.57 g/mol. Its IUPAC name is (1Z)-1-[amino-[1-(2-naphthalen-2-ylethyl)piperidin-3-yl]methylidene]-3-isoquinolin-5-ylurea.
| Compound Name | (1Z)-1-[amino-[1-(2-naphthalen-2-ylethyl)piperidin-3-yl]methylidene]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 177143380 |
| Molecular Formula | C28H29N5O |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (1Z)-1-[amino-[1-(2-naphthalen-2-ylethyl)piperidin-3-yl]methylidene]-3-isoquinolin-5-ylurea |
| SMILES | N/C(=N\C(=O)Nc1cccc2cnccc12)C1CCCN(CCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H29N5O/c29-27(32-28(34)31-26-9-3-7-23-18-30-14-12-25(23)26)24-8-4-15-33(19-24)16-13-20-10-11-21-5-1-2-6-22(21)17-20/h1-3,5-7,9-12,14,17-18,24H,4,8,13,15-16,19H2,(H3,29,31,32,34) |
| InChIKey | XETWELIOJGVTQE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|