C23H34N6O — CID 177143596
(1Z)-1-[amino-[1-(3-ethylhexyl)piperidin-3-yl]methylidene]-3-phthalazin-5-ylurea (PubChem CID 177143596) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is (1Z)-1-[amino-[1-(3-ethylhexyl)piperidin-3-yl]methylidene]-3-phthalazin-5-ylurea.
| Compound Name | (1Z)-1-[amino-[1-(3-ethylhexyl)piperidin-3-yl]methylidene]-3-phthalazin-5-ylurea |
|---|---|
| PubChem CID | 177143596 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (1Z)-1-[amino-[1-(3-ethylhexyl)piperidin-3-yl]methylidene]-3-phthalazin-5-ylurea |
| SMILES | CCCC(CC)CCN1CCCC(/C(N)=N/C(=O)Nc2cccc3cnncc23)C1 |
| InChI | InChI=1S/C23H34N6O/c1-3-7-17(4-2)11-13-29-12-6-9-19(16-29)22(24)28-23(30)27-21-10-5-8-18-14-25-26-15-20(18)21/h5,8,10,14-15,17,19H,3-4,6-7,9,11-13,16H2,1-2H3,(H3,24,27,28,30) |
| InChIKey | QNZGNKMUUVWJOI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|