C27H32N6O2 — CID 177143532
(1Z)-1-[amino-[1-[2-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]piperidin-3-yl]methylidene]-3-(2-oxo-1H-quinolin-8-yl)urea (PubChem CID 177143532) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (1Z)-1-[amino-[1-[2-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]piperidin-3-yl]methylidene]-3-(2-oxo-1H-quinolin-8-yl)urea.
| Compound Name | (1Z)-1-[amino-[1-[2-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]piperidin-3-yl]methylidene]-3-(2-oxo-1H-quinolin-8-yl)urea |
|---|---|
| PubChem CID | 177143532 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (1Z)-1-[amino-[1-[2-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethyl]piperidin-3-yl]methylidene]-3-(2-oxo-1H-quinolin-8-yl)urea |
| SMILES | N/C(=N\C(=O)Nc1cccc2ccc(=O)[nH]c12)C1CCCN(CCc2cccc3c2CNCC3)C1 |
| InChI | InChI=1S/C27H32N6O2/c28-26(32-27(35)30-23-8-2-6-20-9-10-24(34)31-25(20)23)21-7-3-14-33(17-21)15-12-19-5-1-4-18-11-13-29-16-22(18)19/h1-2,4-6,8-10,21,29H,3,7,11-17H2,(H,31,34)(H3,28,30,32,35) |
| InChIKey | QMQMQPQCSPBZQK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|