C11H21N3O3 — CID 177145736
tert-butyl N-[(2S)-1-(1-aminopropylideneamino)-1-oxopropan-2-yl]carbamate (PubChem CID 177145736) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(1-aminopropylideneamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(1-aminopropylideneamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 177145736 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-(1-aminopropylideneamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CC/C(N)=N\C(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21N3O3/c1-6-8(12)14-9(15)7(2)13-10(16)17-11(3,4)5/h7H,6H2,1-5H3,(H,13,16)(H2,12,14,15)/t7-/m0/s1 |
| InChIKey | GQRLJXKTTRNXIN-ZETCQYMHSA-N |
| XLogP | 1.19 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|