C15H18F2N2 — CID 177150249
(5R)-4,5-diethyl-6,6-difluoro-1,5,7,8-tetrahydrobenzo[f]indazole (PubChem CID 177150249) has the molecular formula C15H18F2N2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5R)-4,5-diethyl-6,6-difluoro-1,5,7,8-tetrahydrobenzo[f]indazole.
| Compound Name | (5R)-4,5-diethyl-6,6-difluoro-1,5,7,8-tetrahydrobenzo[f]indazole |
|---|---|
| PubChem CID | 177150249 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5R)-4,5-diethyl-6,6-difluoro-1,5,7,8-tetrahydrobenzo[f]indazole |
| SMILES | CCc1c2c(cc3[nH]ncc13)CCC(F)(F)[C@@H]2CC |
| InChI | InChI=1S/C15H18F2N2/c1-3-10-11-8-18-19-13(11)7-9-5-6-15(16,17)12(4-2)14(9)10/h7-8,12H,3-6H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | ZFASWOIWOKHLCF-GFCCVEGCSA-N |
| XLogP | 4.20 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |