About ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne
ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne (PubChem CID 177154262) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne.
Molecular Properties
| Compound Name | ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne |
| PubChem CID | 177154262 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne |
| SMILES | C#CC.C/C=C\C(C)=N\C.CC.CC |
| InChI | InChI=1S/C6H11N.C3H4.2C2H6/c1-4-5-6(2)7-3;1-3-2;2*1-2/h4-5H,1-3H3;1H,2H3;2*1-2H3/b5-4-,7-6+;;; |
| InChIKey | KHRHSUXZXCMALI-FVBVDTLBSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The IUPAC name of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne (CID 177154262) is ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne.
What is the SMILES notation for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The canonical SMILES for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne is C#CC.C/C=C\C(C)=N\C.CC.CC.
What is the InChIKey of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The InChIKey is KHRHSUXZXCMALI-FVBVDTLBSA-N. The full InChI is InChI=1S/C6H11N.C3H4.2C2H6/c1-4-5-6(2)7-3;1-3-2;2*1-2/h4-5H,1-3H3;1H,2H3;2*1-2H3/b5-4-,7-6+;;;.
What are the key properties of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne has a molecular weight of 197.37 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne is sourced from PubChem (CID 177154262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).