C11H22N2 — CID 177158292
2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane (PubChem CID 177158292) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane.
| Compound Name | 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane |
|---|---|
| PubChem CID | 177158292 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane |
| SMILES | CC.CC1CC(CC#N)CN(C)C1 |
| InChI | InChI=1S/C9H16N2.C2H6/c1-8-5-9(3-4-10)7-11(2)6-8;1-2/h8-9H,3,5-7H2,1-2H3;1-2H3 |
| InChIKey | PRUHKZWHIAPNIA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |