About 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane
2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane (PubChem CID 177158292) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane.
Molecular Properties
| Compound Name | 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane |
| PubChem CID | 177158292 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane |
| SMILES | CC.CC1CC(CC#N)CN(C)C1 |
| InChI | InChI=1S/C9H16N2.C2H6/c1-8-5-9(3-4-10)7-11(2)6-8;1-2/h8-9H,3,5-7H2,1-2H3;1-2H3 |
| InChIKey | PRUHKZWHIAPNIA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane?
The IUPAC name of 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane (CID 177158292) is 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane.
What is the SMILES notation for 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane?
The canonical SMILES for 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane is CC.CC1CC(CC#N)CN(C)C1.
What is the InChIKey of 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane?
The InChIKey is PRUHKZWHIAPNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.C2H6/c1-8-5-9(3-4-10)7-11(2)6-8;1-2/h8-9H,3,5-7H2,1-2H3;1-2H3.
What are the key properties of 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane?
2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane has a molecular weight of 182.31 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylpiperidin-3-yl)acetonitrile;ethane is sourced from PubChem (CID 177158292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).