C28H24ClN3O5 — CID 177158980
2-[2-[6-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 177158980) has the molecular formula C28H24ClN3O5 and a molecular weight of 517.97 g/mol. Its IUPAC name is 2-[2-[6-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[6-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177158980 |
| Molecular Formula | C28H24ClN3O5 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-[2-[6-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CCn2c(CCN3C(=O)c4ccccc4C3=O)nc3ccc(Cl)cc3c2=O)cc1OC |
| InChI | InChI=1S/C28H24ClN3O5/c1-36-23-10-7-17(15-24(23)37-2)11-13-31-25(30-22-9-8-18(29)16-21(22)28(31)35)12-14-32-26(33)19-5-3-4-6-20(19)27(32)34/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | IFYYIPMDRCBRHW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|