C34H36N4O6 — CID 177159086
2-[2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]-4-(2-morpholin-4-ylethyl)isoindole-1,3-dione (PubChem CID 177159086) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-[2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]-4-(2-morpholin-4-ylethyl)isoindole-1,3-dione.
| Compound Name | 2-[2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]-4-(2-morpholin-4-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177159086 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 2-[2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxoquinazolin-2-yl]ethyl]-4-(2-morpholin-4-ylethyl)isoindole-1,3-dione |
| SMILES | COc1ccc(CCn2c(CCN3C(=O)c4cccc(CCN5CCOCC5)c4C3=O)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C34H36N4O6/c1-42-28-11-10-23(22-29(28)43-2)12-16-37-30(35-27-9-4-3-7-25(27)32(37)39)14-17-38-33(40)26-8-5-6-24(31(26)34(38)41)13-15-36-18-20-44-21-19-36/h3-11,22H,12-21H2,1-2H3 |
| InChIKey | AREDHCMYQAKOKV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|