C25H32N4O7 — CID 177161242
2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]piperidin-3-yl]oxyacetic acid (PubChem CID 177161242) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]piperidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]piperidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 177161242 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]piperidin-3-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCCN(CCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C25H32N4O7/c30-20-10-9-19(23(33)27-20)29-24(34)17-7-4-8-18(22(17)25(29)35)26-11-2-1-3-12-28-13-5-6-16(14-28)36-15-21(31)32/h4,7-8,16,19,26H,1-3,5-6,9-15H2,(H,31,32)(H,27,30,33) |
| InChIKey | UOYLRCHGXXMSMS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|