C13H20F3NO — CID 177162613
ethane;(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone (PubChem CID 177162613) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is ethane;(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone.
| Compound Name | ethane;(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 177162613 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethane;(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone |
| SMILES | CC.CC1=CCN(C(=O)C2(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C11H14F3NO.C2H6/c1-8-2-6-15(7-3-8)9(16)10(4-5-10)11(12,13)14;1-2/h2H,3-7H2,1H3;1-2H3 |
| InChIKey | SDCUSEBGZNESGG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|