C20H36O — CID 177164254
2-tert-butyl-1-(methoxymethyl)-5-methyl-3-(2-methylbutan-2-yl)benzene;ethane (PubChem CID 177164254) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-tert-butyl-1-(methoxymethyl)-5-methyl-3-(2-methylbutan-2-yl)benzene;ethane.
| Compound Name | 2-tert-butyl-1-(methoxymethyl)-5-methyl-3-(2-methylbutan-2-yl)benzene;ethane |
|---|---|
| PubChem CID | 177164254 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 2-tert-butyl-1-(methoxymethyl)-5-methyl-3-(2-methylbutan-2-yl)benzene;ethane |
| SMILES | CC.CCC(C)(C)c1cc(C)cc(COC)c1C(C)(C)C |
| InChI | InChI=1S/C18H30O.C2H6/c1-9-18(6,7)15-11-13(2)10-14(12-19-8)16(15)17(3,4)5;1-2/h10-11H,9,12H2,1-8H3;1-2H3 |
| InChIKey | PLVLMGZCFUIBML-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |