C19H19F3N3O2SVW2- — CID 177168584
CID 177168584 (PubChem CID 177168584) has the molecular formula C19H19F3N3O2SVW2- and a molecular weight of 829.06 g/mol.
| Compound Name | CID 177168584 |
|---|---|
| PubChem CID | 177168584 |
| Molecular Formula | C19H19F3N3O2SVW2- |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.96 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccc2c(C(=O)NCC(=O)N3CC(F)(F)CC3=[V])ccnc2c1.F[S-](=[W])=[W] |
| InChI | InChI=1S/C19H19F2N3O2.FS.V.2W/c1-12(2)13-3-4-14-15(5-7-22-16(14)9-13)18(26)23-10-17(25)24-8-6-19(20,21)11-24;1-2;;;/h3-5,7,9,12H,6,10-11H2,1-2H3,(H,23,26);;;;/q;-1;;; |
| InChIKey | JCDZQAQZULINLB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|