C20H24IN3O2 — CID 170378960
N-[2-(2-iodo-3,4,5-trimethylpyrrolidin-1-yl)-2-oxoethyl]-7-methylquinoline-4-carboxamide (PubChem CID 170378960) has the molecular formula C20H24IN3O2 and a molecular weight of 465.34 g/mol. Its IUPAC name is N-[2-(2-iodo-3,4,5-trimethylpyrrolidin-1-yl)-2-oxoethyl]-7-methylquinoline-4-carboxamide.
| Compound Name | N-[2-(2-iodo-3,4,5-trimethylpyrrolidin-1-yl)-2-oxoethyl]-7-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 170378960 |
| Molecular Formula | C20H24IN3O2 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[2-(2-iodo-3,4,5-trimethylpyrrolidin-1-yl)-2-oxoethyl]-7-methylquinoline-4-carboxamide |
| SMILES | Cc1ccc2c(C(=O)NCC(=O)N3C(C)C(C)C(C)C3I)ccnc2c1 |
| InChI | InChI=1S/C20H24IN3O2/c1-11-5-6-15-16(7-8-22-17(15)9-11)20(26)23-10-18(25)24-14(4)12(2)13(3)19(24)21/h5-9,12-14,19H,10H2,1-4H3,(H,23,26) |
| InChIKey | BOIRFMCYBOPBRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|