C24H31FN4O2 — CID 177174653
2-[4-[2-[3-[3-cyano-5-fluoro-2-(methylamino)anilino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene (PubChem CID 177174653) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[4-[2-[3-[3-cyano-5-fluoro-2-(methylamino)anilino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene.
| Compound Name | 2-[4-[2-[3-[3-cyano-5-fluoro-2-(methylamino)anilino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene |
|---|---|
| PubChem CID | 177174653 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-[4-[2-[3-[3-cyano-5-fluoro-2-(methylamino)anilino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene |
| SMILES | C=CC.CNc1c(C#N)cc(F)cc1NCCCNCCc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C21H25FN4O2.C3H6/c1-24-21-17(14-23)12-18(22)13-19(21)26-9-2-8-25-10-7-15-3-5-16(6-4-15)11-20(27)28;1-3-2/h3-6,12-13,24-26H,2,7-11H2,1H3,(H,27,28);3H,1H2,2H3 |
| InChIKey | PHHHTCBCGZOBKW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|