C22H32N4O2 — CID 176990240
2-[3-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene (PubChem CID 176990240) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[3-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene.
| Compound Name | 2-[3-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene |
|---|---|
| PubChem CID | 176990240 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[3-[2-[3-[[2-(methylamino)-3-pyridinyl]amino]propylamino]ethyl]phenyl]acetic acid;prop-1-ene |
| SMILES | C=CC.CNc1ncccc1NCCCNCCc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C19H26N4O2.C3H6/c1-20-19-17(7-3-10-23-19)22-11-4-9-21-12-8-15-5-2-6-16(13-15)14-18(24)25;1-3-2/h2-3,5-7,10,13,21-22H,4,8-9,11-12,14H2,1H3,(H,20,23)(H,24,25);3H,1H2,2H3 |
| InChIKey | WNWJWYIRIJQZFE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|