C27H34FN3O3 — CID 176991351
fluorobenzene;2-[3-[2-[3-[(2-methoxy-3-pyridinyl)amino]propylamino]ethyl]phenyl]-2-methylpropanoic acid (PubChem CID 176991351) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is fluorobenzene;2-[3-[2-[3-[(2-methoxy-3-pyridinyl)amino]propylamino]ethyl]phenyl]-2-methylpropanoic acid.
| Compound Name | fluorobenzene;2-[3-[2-[3-[(2-methoxy-3-pyridinyl)amino]propylamino]ethyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 176991351 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | fluorobenzene;2-[3-[2-[3-[(2-methoxy-3-pyridinyl)amino]propylamino]ethyl]phenyl]-2-methylpropanoic acid |
| SMILES | COc1ncccc1NCCCNCCc1cccc(C(C)(C)C(=O)O)c1.Fc1ccccc1 |
| InChI | InChI=1S/C21H29N3O3.C6H5F/c1-21(2,20(25)26)17-8-4-7-16(15-17)10-14-22-11-6-13-23-18-9-5-12-24-19(18)27-3;7-6-4-2-1-3-5-6/h4-5,7-9,12,15,22-23H,6,10-11,13-14H2,1-3H3,(H,25,26);1-5H |
| InChIKey | JEQZMMYRYPHWIW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|