C20H28N4O2 — CID 176990182
2-[3-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]butanoic acid (PubChem CID 176990182) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[3-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]butanoic acid.
| Compound Name | 2-[3-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 176990182 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[3-[2-[3-[(2-amino-3-pyridinyl)amino]propylamino]ethyl]phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1cccc(CCNCCCNc2cccnc2N)c1 |
| InChI | InChI=1S/C20H28N4O2/c1-2-17(20(25)26)16-7-3-6-15(14-16)9-13-22-10-5-12-23-18-8-4-11-24-19(18)21/h3-4,6-8,11,14,17,22-23H,2,5,9-10,12-13H2,1H3,(H2,21,24)(H,25,26) |
| InChIKey | YAZCIKJBGPXAOO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|