C28H38N4O2 — CID 176991679
3-[3-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]-2,2-dimethylpropanoic acid;benzene (PubChem CID 176991679) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 3-[3-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]-2,2-dimethylpropanoic acid;benzene.
| Compound Name | 3-[3-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]-2,2-dimethylpropanoic acid;benzene |
|---|---|
| PubChem CID | 176991679 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 3-[3-[1-[3-[(2-amino-3-pyridinyl)amino]propylamino]propan-2-yl]phenyl]-2,2-dimethylpropanoic acid;benzene |
| SMILES | CC(CNCCCNc1cccnc1N)c1cccc(CC(C)(C)C(=O)O)c1.c1ccccc1 |
| InChI | InChI=1S/C22H32N4O2.C6H6/c1-16(15-24-10-6-12-25-19-9-5-11-26-20(19)23)18-8-4-7-17(13-18)14-22(2,3)21(27)28;1-2-4-6-5-3-1/h4-5,7-9,11,13,16,24-25H,6,10,12,14-15H2,1-3H3,(H2,23,26)(H,27,28);1-6H |
| InChIKey | YDLLEVUVOUOTOY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|